C14H21F3N2O2 — CID 160866666
(3S)-3-amino-N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propanamide;methane (PubChem CID 160866666) has the molecular formula C14H21F3N2O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is (3S)-3-amino-N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propanamide;methane.
| Compound Name | (3S)-3-amino-N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propanamide;methane |
|---|---|
| PubChem CID | 160866666 |
| Molecular Formula | C14H21F3N2O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3S)-3-amino-N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propanamide;methane |
| SMILES | C.COCCNC(=O)C[C@H](N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O2.CH4/c1-20-6-5-18-12(19)8-11(17)9-3-2-4-10(7-9)13(14,15)16;/h2-4,7,11H,5-6,8,17H2,1H3,(H,18,19);1H4/t11-;/m0./s1 |
| InChIKey | SLEXQTHWNIVYMN-MERQFXBCSA-N |
| XLogP | 2.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|