C21H22F3N3O2 — CID 42782144
N-(2-methoxyethyl)-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 42782144) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42782144 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-(2-methoxyethyl)-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | COCCNC(=O)CC(c1cccc(C(F)(F)F)c1)c1cnc2cccc(C)n12 |
| InChI | InChI=1S/C21H22F3N3O2/c1-14-5-3-8-19-26-13-18(27(14)19)17(12-20(28)25-9-10-29-2)15-6-4-7-16(11-15)21(22,23)24/h3-8,11,13,17H,9-10,12H2,1-2H3,(H,25,28) |
| InChIKey | WGSYKQNHJJBMSW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|