C20H22FN3O2 — CID 42784164
3-(3-fluorophenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide (PubChem CID 42784164) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide.
| Compound Name | 3-(3-fluorophenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 42784164 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
| SMILES | COCCNC(=O)CC(c1cccc(F)c1)c1cnc2cc(C)ccn12 |
| InChI | InChI=1S/C20H22FN3O2/c1-14-6-8-24-18(13-23-19(24)10-14)17(12-20(25)22-7-9-26-2)15-4-3-5-16(21)11-15/h3-6,8,10-11,13,17H,7,9,12H2,1-2H3,(H,22,25) |
| InChIKey | VHWKAUDDOQQABV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|