C22H27N3O4 — CID 42784139
3-(3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide (PubChem CID 42784139) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 42784139 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N-(2-methoxyethyl)-3-(7-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
| SMILES | COCCNC(=O)CC(c1cc(OC)cc(OC)c1)c1cnc2cc(C)ccn12 |
| InChI | InChI=1S/C22H27N3O4/c1-15-5-7-25-20(14-24-21(25)9-15)19(13-22(26)23-6-8-27-2)16-10-17(28-3)12-18(11-16)29-4/h5,7,9-12,14,19H,6,8,13H2,1-4H3,(H,23,26) |
| InChIKey | ABVXFUTWLWGTRW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|