C20H20F3N3O2 — CID 42782151
N-ethoxy-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 42782151) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is N-ethoxy-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-ethoxy-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42782151 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-ethoxy-3-(5-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCONC(=O)CC(c1cccc(C(F)(F)F)c1)c1cnc2cccc(C)n12 |
| InChI | InChI=1S/C20H20F3N3O2/c1-3-28-25-19(27)11-16(14-7-5-8-15(10-14)20(21,22)23)17-12-24-18-9-4-6-13(2)26(17)18/h4-10,12,16H,3,11H2,1-2H3,(H,25,27) |
| InChIKey | RFUUDLPZBFEAJZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|