C20H25F3N2O2 — CID 95771613
1-cyclohexyl-3-[(1S)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-1-prop-2-ynylurea (PubChem CID 95771613) has the molecular formula C20H25F3N2O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1S)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-1-prop-2-ynylurea.
| Compound Name | 1-cyclohexyl-3-[(1S)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 95771613 |
| Molecular Formula | C20H25F3N2O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-cyclohexyl-3-[(1S)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-1-prop-2-ynylurea |
| SMILES | C#CCN(C(=O)N[C@H](COC)c1cccc(C(F)(F)F)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H25F3N2O2/c1-3-12-25(17-10-5-4-6-11-17)19(26)24-18(14-27-2)15-8-7-9-16(13-15)20(21,22)23/h1,7-9,13,17-18H,4-6,10-12,14H2,2H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | STZLQQDFNUZHIH-GOSISDBHSA-N |
| XLogP | 4.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|