C19H27N3O3S — CID 95241425
1-cyclohexyl-3-[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]-1-prop-2-ynylurea (PubChem CID 95241425) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]-1-prop-2-ynylurea.
| Compound Name | 1-cyclohexyl-3-[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 95241425 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-cyclohexyl-3-[(1S)-1-[3-(methanesulfonamido)phenyl]ethyl]-1-prop-2-ynylurea |
| SMILES | C#CCN(C(=O)N[C@@H](C)c1cccc(NS(C)(=O)=O)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H27N3O3S/c1-4-13-22(18-11-6-5-7-12-18)19(23)20-15(2)16-9-8-10-17(14-16)21-26(3,24)25/h1,8-10,14-15,18,21H,5-7,11-13H2,2-3H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | VZEMFZIEYRZEKB-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|