C15H19F3N2O3 — CID 124847956
N-[(1R)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]oxazinane-2-carboxamide (PubChem CID 124847956) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is N-[(1R)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]oxazinane-2-carboxamide.
| Compound Name | N-[(1R)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]oxazinane-2-carboxamide |
|---|---|
| PubChem CID | 124847956 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(1R)-2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]oxazinane-2-carboxamide |
| SMILES | COC[C@H](NC(=O)N1CCCCO1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-22-10-13(19-14(21)20-7-2-3-8-23-20)11-5-4-6-12(9-11)15(16,17)18/h4-6,9,13H,2-3,7-8,10H2,1H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | LXBZFQBJSBVYDL-ZDUSSCGKSA-N |
| XLogP | 3.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |