C20H21F4NO4S — CID 86970872
3-(4-fluorophenyl)sulfonyl-N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]butanamide (PubChem CID 86970872) has the molecular formula C20H21F4NO4S and a molecular weight of 447.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]butanamide.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 86970872 |
| Molecular Formula | C20H21F4NO4S |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]butanamide |
| SMILES | COCC(NC(=O)CC(C)S(=O)(=O)c1ccc(F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F4NO4S/c1-13(30(27,28)17-8-6-16(21)7-9-17)10-19(26)25-18(12-29-2)14-4-3-5-15(11-14)20(22,23)24/h3-9,11,13,18H,10,12H2,1-2H3,(H,25,26) |
| InChIKey | CULAWGAQQREBNF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |