C19H23FO5 — CID 118898131
[3-ethoxy-4-(4-fluorophenyl)-5-(2-methoxyethoxymethoxy)phenyl]methanol (PubChem CID 118898131) has the molecular formula C19H23FO5 and a molecular weight of 350.39 g/mol. Its IUPAC name is [3-ethoxy-4-(4-fluorophenyl)-5-(2-methoxyethoxymethoxy)phenyl]methanol.
| Compound Name | [3-ethoxy-4-(4-fluorophenyl)-5-(2-methoxyethoxymethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 118898131 |
| Molecular Formula | C19H23FO5 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [3-ethoxy-4-(4-fluorophenyl)-5-(2-methoxyethoxymethoxy)phenyl]methanol |
| SMILES | CCOc1cc(CO)cc(OCOCCOC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FO5/c1-3-24-17-10-14(12-21)11-18(25-13-23-9-8-22-2)19(17)15-4-6-16(20)7-5-15/h4-7,10-11,21H,3,8-9,12-13H2,1-2H3 |
| InChIKey | GYTCQXHTMKKOPI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|