C22H22F2O3 — CID 70007811
[3,5-difluoro-4-(4-phenylmethoxyphenyl)phenyl]methanol;ethanol (PubChem CID 70007811) has the molecular formula C22H22F2O3 and a molecular weight of 372.41 g/mol. Its IUPAC name is [3,5-difluoro-4-(4-phenylmethoxyphenyl)phenyl]methanol;ethanol.
| Compound Name | [3,5-difluoro-4-(4-phenylmethoxyphenyl)phenyl]methanol;ethanol |
|---|---|
| PubChem CID | 70007811 |
| Molecular Formula | C22H22F2O3 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [3,5-difluoro-4-(4-phenylmethoxyphenyl)phenyl]methanol;ethanol |
| SMILES | CCO.OCc1cc(F)c(-c2ccc(OCc3ccccc3)cc2)c(F)c1 |
| InChI | InChI=1S/C20H16F2O2.C2H6O/c21-18-10-15(12-23)11-19(22)20(18)16-6-8-17(9-7-16)24-13-14-4-2-1-3-5-14;1-2-3/h1-11,23H,12-13H2;3H,2H2,1H3 |
| InChIKey | WHPJDGVWUZXMML-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |