C20H14F2O2 — CID 170457674
3,5-difluoro-2-(4-phenylmethoxyphenyl)benzaldehyde (PubChem CID 170457674) has the molecular formula C20H14F2O2 and a molecular weight of 324.33 g/mol. Its IUPAC name is 3,5-difluoro-2-(4-phenylmethoxyphenyl)benzaldehyde.
| Compound Name | 3,5-difluoro-2-(4-phenylmethoxyphenyl)benzaldehyde |
|---|---|
| PubChem CID | 170457674 |
| Molecular Formula | C20H14F2O2 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3,5-difluoro-2-(4-phenylmethoxyphenyl)benzaldehyde |
| SMILES | O=Cc1cc(F)cc(F)c1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H14F2O2/c21-17-10-16(12-23)20(19(22)11-17)15-6-8-18(9-7-15)24-13-14-4-2-1-3-5-14/h1-12H,13H2 |
| InChIKey | VPNFLKJCXVYLJA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|