C16H18F2O — CID 142106571
1,3-difluoro-2-methyl-5-phenylmethoxybenzene;ethane (PubChem CID 142106571) has the molecular formula C16H18F2O and a molecular weight of 264.31 g/mol. Its IUPAC name is 1,3-difluoro-2-methyl-5-phenylmethoxybenzene;ethane.
| Compound Name | 1,3-difluoro-2-methyl-5-phenylmethoxybenzene;ethane |
|---|---|
| PubChem CID | 142106571 |
| Molecular Formula | C16H18F2O |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1,3-difluoro-2-methyl-5-phenylmethoxybenzene;ethane |
| SMILES | CC.Cc1c(F)cc(OCc2ccccc2)cc1F |
| InChI | InChI=1S/C14H12F2O.C2H6/c1-10-13(15)7-12(8-14(10)16)17-9-11-5-3-2-4-6-11;1-2/h2-8H,9H2,1H3;1-2H3 |
| InChIKey | HAOFRDKVNHXXEC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |