C15H14F2O2 — CID 134414342
2-(2,6-difluoro-4-phenylmethoxyphenyl)ethanol (PubChem CID 134414342) has the molecular formula C15H14F2O2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-phenylmethoxyphenyl)ethanol.
| Compound Name | 2-(2,6-difluoro-4-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 134414342 |
| Molecular Formula | C15H14F2O2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(2,6-difluoro-4-phenylmethoxyphenyl)ethanol |
| SMILES | OCCc1c(F)cc(OCc2ccccc2)cc1F |
| InChI | InChI=1S/C15H14F2O2/c16-14-8-12(9-15(17)13(14)6-7-18)19-10-11-4-2-1-3-5-11/h1-5,8-9,18H,6-7,10H2 |
| InChIKey | DRQMBPZQDVDXEH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |