C21H27Cl2O5P — CID 90722594
[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]peroxy-pentan-3-ylphosphinic acid (PubChem CID 90722594) has the molecular formula C21H27Cl2O5P and a molecular weight of 461.32 g/mol. Its IUPAC name is [3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]peroxy-pentan-3-ylphosphinic acid.
| Compound Name | [3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]peroxy-pentan-3-ylphosphinic acid |
|---|---|
| PubChem CID | 90722594 |
| Molecular Formula | C21H27Cl2O5P |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]peroxy-pentan-3-ylphosphinic acid |
| SMILES | CCC(CC)P(=O)(O)OOc1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H27Cl2O5P/c1-5-16(6-2)29(25,26)28-27-15-11-19(22)18(20(23)12-15)10-14-7-8-21(24)17(9-14)13(3)4/h7-9,11-13,16,24H,5-6,10H2,1-4H3,(H,25,26) |
| InChIKey | LWCHCXHIGQCXNJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|