C20H23Cl2NO6S — CID 139426706
2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfonic acid (PubChem CID 139426706) has the molecular formula C20H23Cl2NO6S and a molecular weight of 476.38 g/mol. Its IUPAC name is 2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 139426706 |
| Molecular Formula | C20H23Cl2NO6S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfonic acid |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(OCC(=O)NCCS(=O)(=O)O)cc2Cl)ccc1O |
| InChI | InChI=1S/C20H23Cl2NO6S/c1-12(2)15-7-13(3-4-19(15)24)8-16-17(21)9-14(10-18(16)22)29-11-20(25)23-5-6-30(26,27)28/h3-4,7,9-10,12,24H,5-6,8,11H2,1-2H3,(H,23,25)(H,26,27,28) |
| InChIKey | ZPGHKBZCKGNDHS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|