C21H21Cl2NO3 — CID 139426677
2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-N-prop-2-ynylacetamide (PubChem CID 139426677) has the molecular formula C21H21Cl2NO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-N-prop-2-ynylacetamide.
| Compound Name | 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 139426677 |
| Molecular Formula | C21H21Cl2NO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)COc1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2NO3/c1-4-7-24-21(26)12-27-15-10-18(22)17(19(23)11-15)9-14-5-6-20(25)16(8-14)13(2)3/h1,5-6,8,10-11,13,25H,7,9,12H2,2-3H3,(H,24,26) |
| InChIKey | OEZOSDJWXNHEJH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|