C20H22Cl2NO5S- — CID 166119153
2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate (PubChem CID 166119153) has the molecular formula C20H22Cl2NO5S- and a molecular weight of 459.37 g/mol. Its IUPAC name is 2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate.
| Compound Name | 2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate |
|---|---|
| PubChem CID | 166119153 |
| Molecular Formula | C20H22Cl2NO5S- |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 2-[[2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(OCC(=O)NCCS(=O)[O-])cc2Cl)ccc1O |
| InChI | InChI=1S/C20H23Cl2NO5S/c1-12(2)15-7-13(3-4-19(15)24)8-16-17(21)9-14(10-18(16)22)28-11-20(25)23-5-6-29(26)27/h3-4,7,9-10,12,24H,5-6,8,11H2,1-2H3,(H,23,25)(H,26,27)/p-1 |
| InChIKey | IHAOBOHIWUCFOL-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|