C22H28Br2NO5S- — CID 171083537
2-[[2-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate;ethane (PubChem CID 171083537) has the molecular formula C22H28Br2NO5S- and a molecular weight of 578.34 g/mol. Its IUPAC name is 2-[[2-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate;ethane.
| Compound Name | 2-[[2-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate;ethane |
|---|---|
| PubChem CID | 171083537 |
| Molecular Formula | C22H28Br2NO5S- |
| Molecular Weight | 578.34 g/mol |
| Exact Mass | 576.01 |
| IUPAC Name | 2-[[2-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetyl]amino]ethanesulfinate;ethane |
| SMILES | CC.CC(C)c1cc(Cc2c(Br)cc(OCC(=O)NCCS(=O)[O-])cc2Br)ccc1O |
| InChI | InChI=1S/C20H23Br2NO5S.C2H6/c1-12(2)15-7-13(3-4-19(15)24)8-16-17(21)9-14(10-18(16)22)28-11-20(25)23-5-6-29(26)27;1-2/h3-4,7,9-10,12,24H,5-6,8,11H2,1-2H3,(H,23,25)(H,26,27);1-2H3/p-1 |
| InChIKey | JXTABQJZKBRQSH-UHFFFAOYSA-M |
| XLogP | 5.03 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|