C21H24Br2O6S — CID 161036666
5-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-4-oxopentane-1-sulfonic acid (PubChem CID 161036666) has the molecular formula C21H24Br2O6S and a molecular weight of 564.29 g/mol. Its IUPAC name is 5-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-4-oxopentane-1-sulfonic acid.
| Compound Name | 5-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-4-oxopentane-1-sulfonic acid |
|---|---|
| PubChem CID | 161036666 |
| Molecular Formula | C21H24Br2O6S |
| Molecular Weight | 564.29 g/mol |
| Exact Mass | 561.97 |
| IUPAC Name | 5-[3,5-dibromo-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-4-oxopentane-1-sulfonic acid |
| SMILES | CC(C)c1cc(Cc2c(Br)cc(OCC(=O)CCCS(=O)(=O)O)cc2Br)ccc1O |
| InChI | InChI=1S/C21H24Br2O6S/c1-13(2)17-8-14(5-6-21(17)25)9-18-19(22)10-16(11-20(18)23)29-12-15(24)4-3-7-30(26,27)28/h5-6,8,10-11,13,25H,3-4,7,9,12H2,1-2H3,(H,26,27,28) |
| InChIKey | UAIMBJHNGFQDOH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|