C18H20Cl2N2O3 — CID 139426720
2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetohydrazide (PubChem CID 139426720) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetohydrazide.
| Compound Name | 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetohydrazide |
|---|---|
| PubChem CID | 139426720 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]acetohydrazide |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(OCC(=O)NN)cc2Cl)ccc1O |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-10(2)13-5-11(3-4-17(13)23)6-14-15(19)7-12(8-16(14)20)25-9-18(24)22-21/h3-5,7-8,10,23H,6,9,21H2,1-2H3,(H,22,24) |
| InChIKey | HWBQBOOYKXKRDR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|