C16H15BrCl2O — CID 162522320
4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenol (PubChem CID 162522320) has the molecular formula C16H15BrCl2O and a molecular weight of 374.11 g/mol. Its IUPAC name is 4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenol.
| Compound Name | 4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 162522320 |
| Molecular Formula | C16H15BrCl2O |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenol |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(Br)cc2Cl)ccc1O |
| InChI | InChI=1S/C16H15BrCl2O/c1-9(2)12-5-10(3-4-16(12)20)6-13-14(18)7-11(17)8-15(13)19/h3-5,7-9,20H,6H2,1-2H3 |
| InChIKey | KFMPYFFOJVWCIY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |