C19H18Cl2O3 — CID 162522770
(E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]prop-2-enoic acid (PubChem CID 162522770) has the molecular formula C19H18Cl2O3 and a molecular weight of 365.26 g/mol. Its IUPAC name is (E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162522770 |
| Molecular Formula | C19H18Cl2O3 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(/C=C/C(=O)O)cc2Cl)ccc1O |
| InChI | InChI=1S/C19H18Cl2O3/c1-11(2)14-7-12(3-5-18(14)22)8-15-16(20)9-13(10-17(15)21)4-6-19(23)24/h3-7,9-11,22H,8H2,1-2H3,(H,23,24)/b6-4+ |
| InChIKey | WFCJTZZCGDTDSG-GQCTYLIASA-N |
| XLogP | 5.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|