About 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol
4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol (PubChem CID 162522654) has the molecular formula C19H18Cl2F2O3
and a molecular weight of 403.25 g/mol. Its IUPAC name is 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol.
Molecular Properties
| Compound Name | 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol |
| PubChem CID | 162522654 |
| Molecular Formula | C19H18Cl2F2O3 |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol |
| SMILES | C=C(O)C(F)(F)Oc1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2F2O3/c1-10(2)14-6-12(4-5-18(14)25)7-15-16(20)8-13(9-17(15)21)26-19(22,23)11(3)24/h4-6,8-10,24-25H,3,7H2,1-2H3 |
| InChIKey | JXGUSCGRBFLUFY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol?
The IUPAC name of 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol (CID 162522654) is 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol.
What is the SMILES notation for 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol?
The canonical SMILES for 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol is C=C(O)C(F)(F)Oc1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1.
What is the InChIKey of 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol?
The InChIKey is JXGUSCGRBFLUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2F2O3/c1-10(2)14-6-12(4-5-18(14)25)7-15-16(20)8-13(9-17(15)21)26-19(22,23)11(3)24/h4-6,8-10,24-25H,3,7H2,1-2H3.
What are the key properties of 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol?
4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol has a molecular weight of 403.25 g/mol, XLogP of 6.46, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2,6-dichloro-4-(1,1-difluoro-2-hydroxyprop-2-enoxy)phenyl]methyl]-2-propan-2-ylphenol is sourced from PubChem (CID 162522654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).