C22H26Cl2O3 — CID 162522712
(E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-2-methylprop-2-enoic acid;ethane (PubChem CID 162522712) has the molecular formula C22H26Cl2O3 and a molecular weight of 409.35 g/mol. Its IUPAC name is (E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-2-methylprop-2-enoic acid;ethane.
| Compound Name | (E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-2-methylprop-2-enoic acid;ethane |
|---|---|
| PubChem CID | 162522712 |
| Molecular Formula | C22H26Cl2O3 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (E)-3-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenyl]-2-methylprop-2-enoic acid;ethane |
| SMILES | C/C(=C\c1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1)C(=O)O.CC |
| InChI | InChI=1S/C20H20Cl2O3.C2H6/c1-11(2)15-7-13(4-5-19(15)23)8-16-17(21)9-14(10-18(16)22)6-12(3)20(24)25;1-2/h4-7,9-11,23H,8H2,1-3H3,(H,24,25);1-2H3/b12-6+; |
| InChIKey | QFPNVQHAARPLOS-WXIWBVQFSA-N |
| XLogP | 6.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|