C33H34ClNO — CID 162522333
4-[[2-chloro-4-(dibenzylamino)-6-prop-1-en-2-ylphenyl]methyl]-2-propan-2-ylphenol (PubChem CID 162522333) has the molecular formula C33H34ClNO and a molecular weight of 496.09 g/mol. Its IUPAC name is 4-[[2-chloro-4-(dibenzylamino)-6-prop-1-en-2-ylphenyl]methyl]-2-propan-2-ylphenol.
| Compound Name | 4-[[2-chloro-4-(dibenzylamino)-6-prop-1-en-2-ylphenyl]methyl]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 162522333 |
| Molecular Formula | C33H34ClNO |
| Molecular Weight | 496.09 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-[[2-chloro-4-(dibenzylamino)-6-prop-1-en-2-ylphenyl]methyl]-2-propan-2-ylphenol |
| SMILES | C=C(C)c1cc(N(Cc2ccccc2)Cc2ccccc2)cc(Cl)c1Cc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C33H34ClNO/c1-23(2)29-19-28(20-32(34)31(29)18-27-15-16-33(36)30(17-27)24(3)4)35(21-25-11-7-5-8-12-25)22-26-13-9-6-10-14-26/h5-17,19-20,24,36H,1,18,21-22H2,2-4H3 |
| InChIKey | QINKWJRBAMIZFY-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.09 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |