C23H23O6P — CID 15942271
[4-[(3-benzoyl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid (PubChem CID 15942271) has the molecular formula C23H23O6P and a molecular weight of 426.41 g/mol. Its IUPAC name is [4-[(3-benzoyl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid.
| Compound Name | [4-[(3-benzoyl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 15942271 |
| Molecular Formula | C23H23O6P |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [4-[(3-benzoyl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
| SMILES | Cc1cc(OCP(=O)(O)O)cc(C)c1Cc1ccc(O)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H23O6P/c1-15-10-19(29-14-30(26,27)28)11-16(2)20(15)12-17-8-9-22(24)21(13-17)23(25)18-6-4-3-5-7-18/h3-11,13,24H,12,14H2,1-2H3,(H2,26,27,28) |
| InChIKey | WXHXQSMDJLKTLD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|