C21H30NO7PS — CID 91269347
N-[5-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-hydroxyphenyl]methanesulfonamide (PubChem CID 91269347) has the molecular formula C21H30NO7PS and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[5-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 91269347 |
| Molecular Formula | C21H30NO7PS |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[5-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-hydroxyphenyl]methanesulfonamide |
| SMILES | CCOP(=O)(COc1cc(C)c(Cc2ccc(O)c(NS(C)(=O)=O)c2)c(C)c1)OCC |
| InChI | InChI=1S/C21H30NO7PS/c1-6-28-30(24,29-7-2)14-27-18-10-15(3)19(16(4)11-18)12-17-8-9-21(23)20(13-17)22-31(5,25)26/h8-11,13,22-23H,6-7,12,14H2,1-5H3 |
| InChIKey | OSGVHQVTPGHNCV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|