C22H29N2O5P — CID 175973673
6-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 175973673) has the molecular formula C22H29N2O5P and a molecular weight of 432.46 g/mol. Its IUPAC name is 6-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 175973673 |
| Molecular Formula | C22H29N2O5P |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 6-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | CCOP(=O)(COc1cc(C)c(Cc2cnc3c(c2)CCC(=O)N3)c(C)c1)OCC |
| InChI | InChI=1S/C22H29N2O5P/c1-5-28-30(26,29-6-2)14-27-19-9-15(3)20(16(4)10-19)12-17-11-18-7-8-21(25)24-22(18)23-13-17/h9-11,13H,5-8,12,14H2,1-4H3,(H,23,24,25) |
| InChIKey | ZGZPOHYEBHFEPS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|