About 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride
6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride (PubChem CID 155892914) has the molecular formula C8H8BrClN2O
and a molecular weight of 263.52 g/mol. Its IUPAC name is 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride |
| PubChem CID | 155892914 |
| Molecular Formula | C8H8BrClN2O |
| Molecular Weight | 263.52 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCc2cc(Br)cnc2N1 |
| InChI | InChI=1S/C8H7BrN2O.ClH/c9-6-3-5-1-2-7(12)11-8(5)10-4-6;/h3-4H,1-2H2,(H,10,11,12);1H |
| InChIKey | CYRHWJHHKLDNHW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride?
The IUPAC name of 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride (CID 155892914) is 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride.
What is the SMILES notation for 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride?
The canonical SMILES for 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride is Cl.O=C1CCc2cc(Br)cnc2N1.
What is the InChIKey of 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride?
The InChIKey is CYRHWJHHKLDNHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O.ClH/c9-6-3-5-1-2-7(12)11-8(5)10-4-6;/h3-4H,1-2H2,(H,10,11,12);1H.
What are the key properties of 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride?
6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride has a molecular weight of 263.52 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,4-dihydro-1H-1,8-naphthyridin-2-one;hydrochloride is sourced from PubChem (CID 155892914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).