C13H22N2O — CID 143766696
ethane;6-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 143766696) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;6-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | ethane;6-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 143766696 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | ethane;6-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | CC.CC.Cc1cnc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C9H10N2O.2C2H6/c1-6-4-7-2-3-8(12)11-9(7)10-5-6;2*1-2/h4-5H,2-3H2,1H3,(H,10,11,12);2*1-2H3 |
| InChIKey | JPZZAUQOQKQZIW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |