C11H16N2O — CID 143189329
ethane;7-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 143189329) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;7-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | ethane;7-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 143189329 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;7-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | CC.Cc1ccc2c(n1)NC(=O)CC2 |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-6-2-3-7-4-5-8(12)11-9(7)10-6;1-2/h2-3H,4-5H2,1H3,(H,10,11,12);1-2H3 |
| InChIKey | GGCCIZYXCSHWFX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |