C14H18N2O3 — CID 21073408
4-methyl-4-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-2-yl)oxy]pentanal (PubChem CID 21073408) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-methyl-4-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-2-yl)oxy]pentanal.
| Compound Name | 4-methyl-4-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-2-yl)oxy]pentanal |
|---|---|
| PubChem CID | 21073408 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-methyl-4-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-2-yl)oxy]pentanal |
| SMILES | CC(C)(CCC=O)Oc1ccc2c(n1)NC(=O)CC2 |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,8-3-9-17)19-12-7-5-10-4-6-11(18)15-13(10)16-12/h5,7,9H,3-4,6,8H2,1-2H3,(H,15,16,18) |
| InChIKey | ZINSDOYVXCUNLD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|