C10H12N2O — CID 142820616
3-methyl-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one (PubChem CID 142820616) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-methyl-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one.
| Compound Name | 3-methyl-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
|---|---|
| PubChem CID | 142820616 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-methyl-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
| SMILES | Cc1cnc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C10H12N2O/c1-7-5-8-3-2-4-9(13)12-10(8)11-6-7/h5-6H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | WLCARPHJVNAZKH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |