C14H11F3N2O4 — CID 146571804
(2,2,2-trifluoroacetyl) (E)-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enoate (PubChem CID 146571804) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (E)-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enoate.
| Compound Name | (2,2,2-trifluoroacetyl) (E)-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 146571804 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (E)-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enoate |
| SMILES | O=C1CCCc2cc(/C=C/C(=O)OC(=O)C(F)(F)F)cnc2N1 |
| InChI | InChI=1S/C14H11F3N2O4/c15-14(16,17)13(22)23-11(21)5-4-8-6-9-2-1-3-10(20)19-12(9)18-7-8/h4-7H,1-3H2,(H,18,19,20)/b5-4+ |
| InChIKey | XMZZCUWWCZKFDM-SNAWJCMRSA-N |
| XLogP | 2.00 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|