C22H33N3O3 — CID 144568182
tert-butyl (E)-3-(10-oxo-1,7,9-triazatricyclo[10.4.0.03,8]hexadeca-3(8),4,6-trien-5-yl)prop-2-enoate;ethane (PubChem CID 144568182) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl (E)-3-(10-oxo-1,7,9-triazatricyclo[10.4.0.03,8]hexadeca-3(8),4,6-trien-5-yl)prop-2-enoate;ethane.
| Compound Name | tert-butyl (E)-3-(10-oxo-1,7,9-triazatricyclo[10.4.0.03,8]hexadeca-3(8),4,6-trien-5-yl)prop-2-enoate;ethane |
|---|---|
| PubChem CID | 144568182 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | tert-butyl (E)-3-(10-oxo-1,7,9-triazatricyclo[10.4.0.03,8]hexadeca-3(8),4,6-trien-5-yl)prop-2-enoate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)/C=C/c1cnc2c(c1)CN1CCCCC1CC(=O)N2 |
| InChI | InChI=1S/C20H27N3O3.C2H6/c1-20(2,3)26-18(25)8-7-14-10-15-13-23-9-5-4-6-16(23)11-17(24)22-19(15)21-12-14;1-2/h7-8,10,12,16H,4-6,9,11,13H2,1-3H3,(H,21,22,24);1-2H3/b8-7+; |
| InChIKey | CSQNTRIMVWRJOX-USRGLUTNSA-N |
| XLogP | 4.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|