C17H18N4O3 — CID 123873958
tert-butyl 3-(8-oxo-3,5,9,11-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),4,6,11,13-pentaen-13-yl)prop-2-enoate (PubChem CID 123873958) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is tert-butyl 3-(8-oxo-3,5,9,11-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),4,6,11,13-pentaen-13-yl)prop-2-enoate.
| Compound Name | tert-butyl 3-(8-oxo-3,5,9,11-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),4,6,11,13-pentaen-13-yl)prop-2-enoate |
|---|---|
| PubChem CID | 123873958 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | tert-butyl 3-(8-oxo-3,5,9,11-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),4,6,11,13-pentaen-13-yl)prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1cnc2c(c1)Cn1cncc1C(=O)N2 |
| InChI | InChI=1S/C17H18N4O3/c1-17(2,3)24-14(22)5-4-11-6-12-9-21-10-18-8-13(21)16(23)20-15(12)19-7-11/h4-8,10H,9H2,1-3H3,(H,19,20,23) |
| InChIKey | AMJANFXPMZWPFQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|