C16H18N4O4 — CID 123625625
3-(13-acetyl-10-oxo-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)prop-2-enoic acid (PubChem CID 123625625) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-(13-acetyl-10-oxo-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)prop-2-enoic acid.
| Compound Name | 3-(13-acetyl-10-oxo-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 123625625 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-(13-acetyl-10-oxo-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)prop-2-enoic acid |
| SMILES | CC(=O)N1CCN2Cc3cc(C=CC(=O)O)cnc3NC(=O)C2C1 |
| InChI | InChI=1S/C16H18N4O4/c1-10(21)19-4-5-20-8-12-6-11(2-3-14(22)23)7-17-15(12)18-16(24)13(20)9-19/h2-3,6-7,13H,4-5,8-9H2,1H3,(H,22,23)(H,17,18,24) |
| InChIKey | LJYVQYOIBPOHLB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|