C30H33N5O3S — CID 129173039
S-ethyl 10-oxo-5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carbothioate (PubChem CID 129173039) has the molecular formula C30H33N5O3S and a molecular weight of 543.69 g/mol. Its IUPAC name is S-ethyl 10-oxo-5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carbothioate.
| Compound Name | S-ethyl 10-oxo-5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carbothioate |
|---|---|
| PubChem CID | 129173039 |
| Molecular Formula | C30H33N5O3S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | S-ethyl 10-oxo-5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-13-carbothioate |
| SMILES | CCSC(=O)N1CCN2Cc3cc(/C=C/C(=O)N4CC5C=C(c6ccccc6)CC5C4)cnc3NC(=O)C2C1 |
| InChI | InChI=1S/C30H33N5O3S/c1-2-39-30(38)34-11-10-33-18-25-12-20(15-31-28(25)32-29(37)26(33)19-34)8-9-27(36)35-16-23-13-22(14-24(23)17-35)21-6-4-3-5-7-21/h3-9,12-13,15,23-24,26H,2,10-11,14,16-19H2,1H3,(H,31,32,37)/b9-8+ |
| InChIKey | VSJJJPRLIZVYFY-CMDGGOBGSA-N |
| XLogP | 3.97 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|