C25H28N4O3S — CID 123841617
3-(10-hydroxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)-1-(5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-2-en-1-one (PubChem CID 123841617) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-(10-hydroxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)-1-(5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-2-en-1-one.
| Compound Name | 3-(10-hydroxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)-1-(5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123841617 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 3-(10-hydroxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-5-yl)-1-(5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cnc2c(c1)CN1CCOCC1C(O)N2)N1CC2C=C(c3ccsc3)CC2C1 |
| InChI | InChI=1S/C25H28N4O3S/c30-23(29-11-19-8-18(9-20(19)12-29)17-3-6-33-15-17)2-1-16-7-21-13-28-4-5-32-14-22(28)25(31)27-24(21)26-10-16/h1-3,6-8,10,15,19-20,22,25,31H,4-5,9,11-14H2,(H,26,27) |
| InChIKey | DASFWXPTPZEPPE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|