C27H27N5O3 — CID 123569353
5-[3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione (PubChem CID 123569353) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 5-[3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione.
| Compound Name | 5-[3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione |
|---|---|
| PubChem CID | 123569353 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 5-[3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-1,7,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione |
| SMILES | O=C1Nc2ncc(C=CC(=O)N3CC4C=C(c5ccccc5)CC4C3)cc2C(=O)N2CCNCC12 |
| InChI | InChI=1S/C27H27N5O3/c33-24(31-15-20-11-19(12-21(20)16-31)18-4-2-1-3-5-18)7-6-17-10-22-25(29-13-17)30-26(34)23-14-28-8-9-32(23)27(22)35/h1-7,10-11,13,20-21,23,28H,8-9,12,14-16H2,(H,29,30,34) |
| InChIKey | MGGKYOPGGVJMIA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|