C8H7BF3N2O- — CID 167722785
trifluoro-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)boranuide (PubChem CID 167722785) has the molecular formula C8H7BF3N2O- and a molecular weight of 214.96 g/mol. Its IUPAC name is trifluoro-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)boranuide.
| Compound Name | trifluoro-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)boranuide |
|---|---|
| PubChem CID | 167722785 |
| Molecular Formula | C8H7BF3N2O- |
| Molecular Weight | 214.96 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | trifluoro-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)boranuide |
| SMILES | O=C1CCc2cc([B-](F)(F)F)cnc2N1 |
| InChI | InChI=1S/C8H7BF3N2O/c10-9(11,12)6-3-5-1-2-7(15)14-8(5)13-4-6/h3-4H,1-2H2,(H,13,14,15)/q-1 |
| InChIKey | OTABHZKDDKTFKI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.96 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|