C4H6BF4NO2 — CID 174783569
hydron;pyrrolidine-2,5-dione;tetrafluoroborate (PubChem CID 174783569) has the molecular formula C4H6BF4NO2 and a molecular weight of 186.90 g/mol. Its IUPAC name is hydron;pyrrolidine-2,5-dione;tetrafluoroborate.
| Compound Name | hydron;pyrrolidine-2,5-dione;tetrafluoroborate |
|---|---|
| PubChem CID | 174783569 |
| Molecular Formula | C4H6BF4NO2 |
| Molecular Weight | 186.90 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | hydron;pyrrolidine-2,5-dione;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.O=C1CCC(=O)N1.[H+] |
| InChI | InChI=1S/C4H5NO2.BF4/c6-3-1-2-4(7)5-3;2-1(3,4)5/h1-2H2,(H,5,6,7);/q;-1/p+1 |
| InChIKey | XMLPXAXCNLDEMJ-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.90 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|