C23H34NO4P — CID 91146658
4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylaniline (PubChem CID 91146658) has the molecular formula C23H34NO4P and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylaniline.
| Compound Name | 4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylaniline |
|---|---|
| PubChem CID | 91146658 |
| Molecular Formula | C23H34NO4P |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylaniline |
| SMILES | CCOP(=O)(COc1cc(C)c(Cc2ccc(N)c(C(C)C)c2)c(C)c1)OCC |
| InChI | InChI=1S/C23H34NO4P/c1-7-27-29(25,28-8-2)15-26-20-11-17(5)22(18(6)12-20)14-19-9-10-23(24)21(13-19)16(3)4/h9-13,16H,7-8,14-15,24H2,1-6H3 |
| InChIKey | JHOSXWRLEORNOK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|