C28H45O5PSi — CID 68814131
[3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenoxy]methylphosphonic acid (PubChem CID 68814131) has the molecular formula C28H45O5PSi and a molecular weight of 520.72 g/mol. Its IUPAC name is [3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenoxy]methylphosphonic acid.
| Compound Name | [3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 68814131 |
| Molecular Formula | C28H45O5PSi |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenoxy]methylphosphonic acid |
| SMILES | Cc1cc(OCP(=O)(O)O)cc(C)c1Cc1ccc(O[Si](C(C)C)(C(C)C)C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C28H45O5PSi/c1-18(2)26-15-24(11-12-28(26)33-35(19(3)4,20(5)6)21(7)8)16-27-22(9)13-25(14-23(27)10)32-17-34(29,30)31/h11-15,18-21H,16-17H2,1-10H3,(H2,29,30,31) |
| InChIKey | PVAOOMFPRMSGOZ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|