C30H46O3Si — CID 11070919
3-[3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenyl]propanoic acid (PubChem CID 11070919) has the molecular formula C30H46O3Si and a molecular weight of 482.78 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11070919 |
| Molecular Formula | C30H46O3Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | 3-[3,5-dimethyl-4-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]phenyl]propanoic acid |
| SMILES | Cc1cc(CCC(=O)O)cc(C)c1Cc1ccc(O[Si](C(C)C)(C(C)C)C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C30H46O3Si/c1-19(2)27-17-26(11-13-29(27)33-34(20(3)4,21(5)6)22(7)8)18-28-23(9)15-25(16-24(28)10)12-14-30(31)32/h11,13,15-17,19-22H,12,14,18H2,1-10H3,(H,31,32) |
| InChIKey | QOVGQDFIWLGYND-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|