C21H27I2O6P — CID 87487379
[2,6-diiodo-4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid (PubChem CID 87487379) has the molecular formula C21H27I2O6P and a molecular weight of 660.22 g/mol. Its IUPAC name is [2,6-diiodo-4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid.
| Compound Name | [2,6-diiodo-4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 87487379 |
| Molecular Formula | C21H27I2O6P |
| Molecular Weight | 660.22 g/mol |
| Exact Mass | 659.96 |
| IUPAC Name | [2,6-diiodo-4-[[4-(methoxymethoxy)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
| SMILES | COCOc1ccc(Cc2c(C)c(I)c(OCP(=O)(O)O)c(I)c2C)cc1C(C)C |
| InChI | InChI=1S/C21H27I2O6P/c1-12(2)16-8-15(6-7-18(16)28-10-27-5)9-17-13(3)19(22)21(20(23)14(17)4)29-11-30(24,25)26/h6-8,12H,9-11H2,1-5H3,(H2,24,25,26) |
| InChIKey | MZUMRQWKNNRPOO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.22 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|