C16H17Cl2O6P — CID 141114258
[3,5-dichloro-4-(4-hydroxy-2-propan-2-ylphenoxy)phenoxy]methylphosphonic acid (PubChem CID 141114258) has the molecular formula C16H17Cl2O6P and a molecular weight of 407.19 g/mol. Its IUPAC name is [3,5-dichloro-4-(4-hydroxy-2-propan-2-ylphenoxy)phenoxy]methylphosphonic acid.
| Compound Name | [3,5-dichloro-4-(4-hydroxy-2-propan-2-ylphenoxy)phenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 141114258 |
| Molecular Formula | C16H17Cl2O6P |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | [3,5-dichloro-4-(4-hydroxy-2-propan-2-ylphenoxy)phenoxy]methylphosphonic acid |
| SMILES | CC(C)c1cc(O)ccc1Oc1c(Cl)cc(OCP(=O)(O)O)cc1Cl |
| InChI | InChI=1S/C16H17Cl2O6P/c1-9(2)12-5-10(19)3-4-15(12)24-16-13(17)6-11(7-14(16)18)23-8-25(20,21)22/h3-7,9,19H,8H2,1-2H3,(H2,20,21,22) |
| InChIKey | KYGLUKVZCHCKNE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|