C18H23Cl2N2O6P — CID 175072246
3-[2,6-dichloro-4-(diethoxyphosphorylmethoxy)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one (PubChem CID 175072246) has the molecular formula C18H23Cl2N2O6P and a molecular weight of 465.27 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(diethoxyphosphorylmethoxy)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one.
| Compound Name | 3-[2,6-dichloro-4-(diethoxyphosphorylmethoxy)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 175072246 |
| Molecular Formula | C18H23Cl2N2O6P |
| Molecular Weight | 465.27 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 3-[2,6-dichloro-4-(diethoxyphosphorylmethoxy)phenoxy]-5-propan-2-yl-1H-pyridazin-6-one |
| SMILES | CCOP(=O)(COc1cc(Cl)c(Oc2cc(C(C)C)c(=O)[nH]n2)c(Cl)c1)OCC |
| InChI | InChI=1S/C18H23Cl2N2O6P/c1-5-26-29(24,27-6-2)10-25-12-7-14(19)17(15(20)8-12)28-16-9-13(11(3)4)18(23)22-21-16/h7-9,11H,5-6,10H2,1-4H3,(H,22,23) |
| InChIKey | FBLJDJCCCWOEKJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.27 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|