C13H14ClN3O3 — CID 177323780
3-(4-amino-2-chloro-6-hydroxyphenoxy)-5-propan-2-yl-1H-pyridazin-6-one (PubChem CID 177323780) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 3-(4-amino-2-chloro-6-hydroxyphenoxy)-5-propan-2-yl-1H-pyridazin-6-one.
| Compound Name | 3-(4-amino-2-chloro-6-hydroxyphenoxy)-5-propan-2-yl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 177323780 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-(4-amino-2-chloro-6-hydroxyphenoxy)-5-propan-2-yl-1H-pyridazin-6-one |
| SMILES | CC(C)c1cc(Oc2c(O)cc(N)cc2Cl)n[nH]c1=O |
| InChI | InChI=1S/C13H14ClN3O3/c1-6(2)8-5-11(16-17-13(8)19)20-12-9(14)3-7(15)4-10(12)18/h3-6,18H,15H2,1-2H3,(H,17,19) |
| InChIKey | XYJDVGSZXWABFX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|